C31H38N4O5 — CID 87637798
N-[1-[4-[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]phenyl]piperidin-4-yl]oxybenzamide (PubChem CID 87637798) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is N-[1-[4-[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]phenyl]piperidin-4-yl]oxybenzamide.
| Compound Name | N-[1-[4-[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]phenyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 87637798 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | N-[1-[4-[2-methoxy-4-(pentan-3-ylcarbamoylamino)phenoxy]phenyl]piperidin-4-yl]oxybenzamide |
| SMILES | CCC(CC)NC(=O)Nc1ccc(Oc2ccc(N3CCC(ONC(=O)c4ccccc4)CC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C31H38N4O5/c1-4-23(5-2)32-31(37)33-24-11-16-28(29(21-24)38-3)39-26-14-12-25(13-15-26)35-19-17-27(18-20-35)40-34-30(36)22-9-7-6-8-10-22/h6-16,21,23,27H,4-5,17-20H2,1-3H3,(H,34,36)(H2,32,33,37) |
| InChIKey | UCJJFIZTONESKU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|