C34H44N4O4 — CID 69144788
N-[3-methyl-4-[3-(pentylcarbamoylamino)phenoxy]phenyl]-4-(1-propan-2-ylpiperidin-3-yl)oxybenzamide (PubChem CID 69144788) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is N-[3-methyl-4-[3-(pentylcarbamoylamino)phenoxy]phenyl]-4-(1-propan-2-ylpiperidin-3-yl)oxybenzamide.
| Compound Name | N-[3-methyl-4-[3-(pentylcarbamoylamino)phenoxy]phenyl]-4-(1-propan-2-ylpiperidin-3-yl)oxybenzamide |
|---|---|
| PubChem CID | 69144788 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | N-[3-methyl-4-[3-(pentylcarbamoylamino)phenoxy]phenyl]-4-(1-propan-2-ylpiperidin-3-yl)oxybenzamide |
| SMILES | CCCCCNC(=O)Nc1cccc(Oc2ccc(NC(=O)c3ccc(OC4CCCN(C(C)C)C4)cc3)cc2C)c1 |
| InChI | InChI=1S/C34H44N4O4/c1-5-6-7-19-35-34(40)37-27-10-8-11-30(22-27)42-32-18-15-28(21-25(32)4)36-33(39)26-13-16-29(17-14-26)41-31-12-9-20-38(23-31)24(2)3/h8,10-11,13-18,21-22,24,31H,5-7,9,12,19-20,23H2,1-4H3,(H,36,39)(H2,35,37,40) |
| InChIKey | URIBYZUZDVQRPM-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|