C17H17FN6O — CID 86988801
1-[(3-fluorophenyl)methyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 86988801) has the molecular formula C17H17FN6O and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 86988801 |
| Molecular Formula | C17H17FN6O |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)N(C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H17FN6O/c1-12-20-21-22-24(12)16-8-4-7-15(10-16)19-17(25)23(2)11-13-5-3-6-14(18)9-13/h3-10H,11H2,1-2H3,(H,19,25) |
| InChIKey | FGLJRLACBNYWNE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |