C18H19FN6O2 — CID 55698026
1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 55698026) has the molecular formula C18H19FN6O2 and a molecular weight of 370.39 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 55698026 |
| Molecular Formula | C18H19FN6O2 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)N(C)CCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FN6O2/c1-13-21-22-23-25(13)16-5-3-4-15(12-16)20-18(26)24(2)10-11-27-17-8-6-14(19)7-9-17/h3-9,12H,10-11H2,1-2H3,(H,20,26) |
| InChIKey | HSRJYBPIGCVBNB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |