C22H22FN3O2S — CID 56554634
1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea (PubChem CID 56554634) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56554634 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)Nc1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-26(13-14-28-20-10-8-18(23)9-11-20)22(27)25-19-6-4-5-17(15-19)16-29-21-7-2-3-12-24-21/h2-12,15H,13-14,16H2,1H3,(H,25,27) |
| InChIKey | UUZPDQOYIDMEEO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |