C23H25N3O2S — CID 56554852
1-[(3-propan-2-yloxyphenyl)methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea (PubChem CID 56554852) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-[(3-propan-2-yloxyphenyl)methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea.
| Compound Name | 1-[(3-propan-2-yloxyphenyl)methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56554852 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[(3-propan-2-yloxyphenyl)methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
| SMILES | CC(C)Oc1cccc(CNC(=O)Nc2cccc(CSc3ccccn3)c2)c1 |
| InChI | InChI=1S/C23H25N3O2S/c1-17(2)28-21-10-6-7-18(14-21)15-25-23(27)26-20-9-5-8-19(13-20)16-29-22-11-3-4-12-24-22/h3-14,17H,15-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | HYUHTSZMIWBCTQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |