C22H31N3O4S — CID 56566322
1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea (PubChem CID 56566322) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea.
| Compound Name | 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56566322 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-1-methyl-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
| SMILES | CC(C)OCCOCC(O)CN(C)C(=O)Nc1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C22H31N3O4S/c1-17(2)29-12-11-28-15-20(26)14-25(3)22(27)24-19-8-6-7-18(13-19)16-30-21-9-4-5-10-23-21/h4-10,13,17,20,26H,11-12,14-16H2,1-3H3,(H,24,27) |
| InChIKey | QYNILPQIKJWJJQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|