C22H35N3O6 — CID 56566060
1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1-methylurea (PubChem CID 56566060) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1-methylurea.
| Compound Name | 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 56566060 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)CC(O)COCCOC(C)C)cc1N1CCCCC1=O |
| InChI | InChI=1S/C22H35N3O6/c1-16(2)31-12-11-30-15-18(26)14-24(3)22(28)23-17-8-9-20(29-4)19(13-17)25-10-6-5-7-21(25)27/h8-9,13,16,18,26H,5-7,10-12,14-15H2,1-4H3,(H,23,28) |
| InChIKey | OSAMYNFQYVAONU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|