C18H25N3O5 — CID 122076235
3-[[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122076235) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122076235 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | COc1ccc(NC(=O)N(C)CC(C)C(=O)O)cc1N1CCCCC1=O |
| InChI | InChI=1S/C18H25N3O5/c1-12(17(23)24)11-20(2)18(25)19-13-7-8-15(26-3)14(10-13)21-9-5-4-6-16(21)22/h7-8,10,12H,4-6,9,11H2,1-3H3,(H,19,25)(H,23,24) |
| InChIKey | GECFVPVXLYTVET-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |