C23H33N3O5 — CID 47041591
3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1,1-bis(oxolan-2-ylmethyl)urea (PubChem CID 47041591) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1,1-bis(oxolan-2-ylmethyl)urea.
| Compound Name | 3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1,1-bis(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47041591 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-1,1-bis(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC2CCCO2)CC2CCCO2)cc1N1CCCCC1=O |
| InChI | InChI=1S/C23H33N3O5/c1-29-21-10-9-17(14-20(21)26-11-3-2-8-22(26)27)24-23(28)25(15-18-6-4-12-30-18)16-19-7-5-13-31-19/h9-10,14,18-19H,2-8,11-13,15-16H2,1H3,(H,24,28) |
| InChIKey | YBJZQQPXRLLDKZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |