C20H24N2O4 — CID 52511984
3-(3-acetylphenyl)-1-[(2S)-2-hydroxy-3-phenylmethoxypropyl]-1-methylurea (PubChem CID 52511984) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1-[(2S)-2-hydroxy-3-phenylmethoxypropyl]-1-methylurea.
| Compound Name | 3-(3-acetylphenyl)-1-[(2S)-2-hydroxy-3-phenylmethoxypropyl]-1-methylurea |
|---|---|
| PubChem CID | 52511984 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-(3-acetylphenyl)-1-[(2S)-2-hydroxy-3-phenylmethoxypropyl]-1-methylurea |
| SMILES | CC(=O)c1cccc(NC(=O)N(C)C[C@H](O)COCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-15(23)17-9-6-10-18(11-17)21-20(25)22(2)12-19(24)14-26-13-16-7-4-3-5-8-16/h3-11,19,24H,12-14H2,1-2H3,(H,21,25)/t19-/m0/s1 |
| InChIKey | HELNSEZQZDDISI-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |