C18H20N2O5 — CID 119182403
6-[(2-hydroxy-3-phenylmethoxypropyl)-methylcarbamoyl]pyridine-2-carboxylic acid (PubChem CID 119182403) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 6-[(2-hydroxy-3-phenylmethoxypropyl)-methylcarbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2-hydroxy-3-phenylmethoxypropyl)-methylcarbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119182403 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 6-[(2-hydroxy-3-phenylmethoxypropyl)-methylcarbamoyl]pyridine-2-carboxylic acid |
| SMILES | CN(CC(O)COCc1ccccc1)C(=O)c1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C18H20N2O5/c1-20(17(22)15-8-5-9-16(19-15)18(23)24)10-14(21)12-25-11-13-6-3-2-4-7-13/h2-9,14,21H,10-12H2,1H3,(H,23,24) |
| InChIKey | LRKAVZRIZMXQIT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |