C24H27N3O2S — CID 86942896
2-[2-hydroxyethyl(2-phenylethyl)amino]-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide (PubChem CID 86942896) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-phenylethyl)amino]-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-[2-hydroxyethyl(2-phenylethyl)amino]-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86942896 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[2-hydroxyethyl(2-phenylethyl)amino]-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
| SMILES | O=C(CN(CCO)CCc1ccccc1)Nc1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C24H27N3O2S/c28-16-15-27(14-12-20-7-2-1-3-8-20)18-23(29)26-22-10-6-9-21(17-22)19-30-24-11-4-5-13-25-24/h1-11,13,17,28H,12,14-16,18-19H2,(H,26,29) |
| InChIKey | LPACTEYUPLFHOL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |