C25H25N3O2S — CID 56577093
2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide (PubChem CID 56577093) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 56577093 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(CSc2ccccn2)c1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H25N3O2S/c29-23-14-5-7-16-28(23)24(20-10-2-1-3-11-20)25(30)27-21-12-8-9-19(17-21)18-31-22-13-4-6-15-26-22/h1-4,6,8-13,15,17,24H,5,7,14,16,18H2,(H,27,30) |
| InChIKey | GOWWQKOGKFQGCB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |