C23H26N2O2S2 — CID 56516841
N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56516841) has the molecular formula C23H26N2O2S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56516841 |
| Molecular Formula | C23H26N2O2S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C23H26N2O2S2/c26-20-12-4-5-13-25(20)21(17-8-2-1-3-9-17)22(27)24-19-11-6-10-18(16-19)23-28-14-7-15-29-23/h1-3,6,8-11,16,21,23H,4-5,7,12-15H2,(H,24,27) |
| InChIKey | FRYGQLPCQVOBDN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |