C25H31N3O2 — CID 56513814
2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(piperidin-1-ylmethyl)phenyl]acetamide (PubChem CID 56513814) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(piperidin-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(piperidin-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 56513814 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[3-(piperidin-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(CN2CCCCC2)c1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H31N3O2/c29-23-14-5-8-17-28(23)24(21-11-3-1-4-12-21)25(30)26-22-13-9-10-20(18-22)19-27-15-6-2-7-16-27/h1,3-4,9-13,18,24H,2,5-8,14-17,19H2,(H,26,30) |
| InChIKey | QNXRYRCELRGEHI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |