C24H28N2O3 — CID 56515228
N-(3-cyclopentyloxyphenyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56515228) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-(3-cyclopentyloxyphenyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-(3-cyclopentyloxyphenyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56515228 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-(3-cyclopentyloxyphenyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(Nc1cccc(OC2CCCC2)c1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C24H28N2O3/c27-22-15-6-7-16-26(22)23(18-9-2-1-3-10-18)24(28)25-19-11-8-14-21(17-19)29-20-12-4-5-13-20/h1-3,8-11,14,17,20,23H,4-7,12-13,15-16H2,(H,25,28) |
| InChIKey | MMLUZTYJCVOGPE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |