C25H24FN3O4S — CID 56514636
N-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56514636) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56514636 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc(F)c2)cc1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H24FN3O4S/c26-19-9-6-10-21(17-19)28-34(32,33)22-14-12-20(13-15-22)27-25(31)24(18-7-2-1-3-8-18)29-16-5-4-11-23(29)30/h1-3,6-10,12-15,17,24,28H,4-5,11,16H2,(H,27,31) |
| InChIKey | MSYURHVNRKYANQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |