C22H26N6O2S — CID 56554374
1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea (PubChem CID 56554374) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is 1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea.
| Compound Name | 1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56554374 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
| SMILES | O=C(NCCCn1nc2n(c1=O)CCCC2)Nc1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C22H26N6O2S/c29-21(24-12-6-14-28-22(30)27-13-4-2-9-19(27)26-28)25-18-8-5-7-17(15-18)16-31-20-10-1-3-11-23-20/h1,3,5,7-8,10-11,15H,2,4,6,9,12-14,16H2,(H2,24,25,29) |
| InChIKey | FEYMHEHAHRASDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|