C20H20N4O2 — CID 124887769
(2S)-N-imidazo[1,2-a]pyridin-5-yl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 124887769) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2S)-N-imidazo[1,2-a]pyridin-5-yl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | (2S)-N-imidazo[1,2-a]pyridin-5-yl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 124887769 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2S)-N-imidazo[1,2-a]pyridin-5-yl-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(Nc1cccc2nccn12)[C@H](c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C20H20N4O2/c25-18-11-4-5-13-24(18)19(15-7-2-1-3-8-15)20(26)22-17-10-6-9-16-21-12-14-23(16)17/h1-3,6-10,12,14,19H,4-5,11,13H2,(H,22,26)/t19-/m0/s1 |
| InChIKey | SXRCPRBSLKDBCU-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |