C20H17FN2OS2 — CID 52803481
2-(2-fluorophenyl)sulfanyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide (PubChem CID 52803481) has the molecular formula C20H17FN2OS2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52803481 |
| Molecular Formula | C20H17FN2OS2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)Nc1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C20H17FN2OS2/c21-17-8-1-2-9-18(17)25-14-19(24)23-16-7-5-6-15(12-16)13-26-20-10-3-4-11-22-20/h1-12H,13-14H2,(H,23,24) |
| InChIKey | YGGXTAGYGHSFJG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |