C23H22FN3OS — CID 56554792
2-(4-fluorophenyl)-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 56554792) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 56554792 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(CSc2ccccn2)c1)N1CCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3OS/c24-19-11-9-18(10-12-19)21-7-4-14-27(21)23(28)26-20-6-3-5-17(15-20)16-29-22-8-1-2-13-25-22/h1-3,5-6,8-13,15,21H,4,7,14,16H2,(H,26,28) |
| InChIKey | DGURGQFECIJDOX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |