C18H19FN6O — CID 92613812
(2R)-2-(dimethylamino)-2-(4-fluorophenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide (PubChem CID 92613812) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide.
| Compound Name | (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 92613812 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)[C@@H](c2ccc(F)cc2)N(C)C)c1 |
| InChI | InChI=1S/C18H19FN6O/c1-12-21-22-23-25(12)16-6-4-5-15(11-16)20-18(26)17(24(2)3)13-7-9-14(19)10-8-13/h4-11,17H,1-3H3,(H,20,26)/t17-/m1/s1 |
| InChIKey | GEVBCMBDYNGORU-QGZVFWFLSA-N |
| XLogP | 2.35 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |