C17H21N7OS — CID 51946045
1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 51946045) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 51946045 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)NC[C@H](c2ccsc2)N(C)C)c1 |
| InChI | InChI=1S/C17H21N7OS/c1-12-20-21-22-24(12)15-6-4-5-14(9-15)19-17(25)18-10-16(23(2)3)13-7-8-26-11-13/h4-9,11,16H,10H2,1-3H3,(H2,18,19,25)/t16-/m1/s1 |
| InChIKey | ZRVHXOXGWYKIGY-MRXNPFEDSA-N |
| XLogP | 2.46 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |