C18H24N4O2S — CID 55745225
N-[5-[[2-(dimethylamino)-2-thiophen-3-ylethyl]carbamoylamino]-2-methylphenyl]acetamide (PubChem CID 55745225) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[5-[[2-(dimethylamino)-2-thiophen-3-ylethyl]carbamoylamino]-2-methylphenyl]acetamide.
| Compound Name | N-[5-[[2-(dimethylamino)-2-thiophen-3-ylethyl]carbamoylamino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 55745225 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[5-[[2-(dimethylamino)-2-thiophen-3-ylethyl]carbamoylamino]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC(=O)NCC(c2ccsc2)N(C)C)ccc1C |
| InChI | InChI=1S/C18H24N4O2S/c1-12-5-6-15(9-16(12)20-13(2)23)21-18(24)19-10-17(22(3)4)14-7-8-25-11-14/h5-9,11,17H,10H2,1-4H3,(H,20,23)(H2,19,21,24) |
| InChIKey | QXQYVMAGNWCAHP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |