C21H22N2O4 — CID 120549335
1-[2-[3-[methyl(phenyl)carbamoyl]anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid (PubChem CID 120549335) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[2-[3-[methyl(phenyl)carbamoyl]anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-[3-[methyl(phenyl)carbamoyl]anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120549335 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[2-[3-[methyl(phenyl)carbamoyl]anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid |
| SMILES | CN(C(=O)c1cccc(NC(=O)CC2(C(=O)O)CCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c1-23(17-9-3-2-4-10-17)19(25)15-7-5-8-16(13-15)22-18(24)14-21(20(26)27)11-6-12-21/h2-5,7-10,13H,6,11-12,14H2,1H3,(H,22,24)(H,26,27) |
| InChIKey | XSNGABNGXFAJFW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |