C16H20N2O4S — CID 49247310
3-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]thiolane-3-carboxylic acid (PubChem CID 49247310) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]thiolane-3-carboxylic acid.
| Compound Name | 3-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 49247310 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]thiolane-3-carboxylic acid |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)CC2(C(=O)O)CCSC2)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-18(2)14(20)11-4-3-5-12(8-11)17-13(19)9-16(15(21)22)6-7-23-10-16/h3-5,8H,6-7,9-10H2,1-2H3,(H,17,19)(H,21,22) |
| InChIKey | OYDNMRTZIVNWRU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |