C19H22N4O4 — CID 55719787
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide (PubChem CID 55719787) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55719787 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C19H22N4O4/c24-16(11-23-17(25)14-6-1-2-7-15(14)18(23)26)21-12-4-3-5-13(10-12)22-9-8-20-19(22)27/h3-5,10,14-15H,1-2,6-9,11H2,(H,20,27)(H,21,24) |
| InChIKey | UUEGLKLHPMHSFX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|