C14H18N4O2 — CID 100624959
1-(2-methylprop-2-enyl)-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 100624959) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-(2-methylprop-2-enyl)-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 100624959 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | C=C(C)CNC(=O)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-10(2)9-16-13(19)17-11-4-3-5-12(8-11)18-7-6-15-14(18)20/h3-5,8H,1,6-7,9H2,2H3,(H,15,20)(H2,16,17,19) |
| InChIKey | VQZJJDAHTFUWRM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|