C17H20N4O2S — CID 95904318
1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[(2R)-2-thiophen-3-ylpropyl]urea (PubChem CID 95904318) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[(2R)-2-thiophen-3-ylpropyl]urea.
| Compound Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[(2R)-2-thiophen-3-ylpropyl]urea |
|---|---|
| PubChem CID | 95904318 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[(2R)-2-thiophen-3-ylpropyl]urea |
| SMILES | C[C@@H](CNC(=O)Nc1cccc(N2CCNC2=O)c1)c1ccsc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12(13-5-8-24-11-13)10-19-16(22)20-14-3-2-4-15(9-14)21-7-6-18-17(21)23/h2-5,8-9,11-12H,6-7,10H2,1H3,(H,18,23)(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | NDUXUPCEACOXCG-LBPRGKRZSA-N |
| XLogP | 3.20 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |