C18H26N2O5S — CID 55642293
2-methylsulfonyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide (PubChem CID 55642293) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide.
| Compound Name | 2-methylsulfonyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55642293 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-methylsulfonyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O5S/c1-26(22,23)17-5-3-2-4-15(17)18(21)19-12-16(14-6-9-25-13-14)20-7-10-24-11-8-20/h2-5,14,16H,6-13H2,1H3,(H,19,21) |
| InChIKey | AJZQFGHVAHLAOL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |