C24H33N3O4 — CID 46581199
3-ethoxy-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 46581199) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-ethoxy-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 3-ethoxy-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46581199 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-ethoxy-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCC2CN(CC(C)C)CCO2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C24H33N3O4/c1-4-29-23-12-20(7-8-22(23)31-17-19-6-5-9-25-13-19)24(28)26-14-21-16-27(10-11-30-21)15-18(2)3/h5-9,12-13,18,21H,4,10-11,14-17H2,1-3H3,(H,26,28) |
| InChIKey | GGOIFPRQHIGNGZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |