C17H18N2O3 — CID 87024322
5-[(2-cyanophenoxy)methyl]-N-methyl-N-propan-2-ylfuran-2-carboxamide (PubChem CID 87024322) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-methyl-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-methyl-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 87024322 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-methyl-N-propan-2-ylfuran-2-carboxamide |
| SMILES | CC(C)N(C)C(=O)c1ccc(COc2ccccc2C#N)o1 |
| InChI | InChI=1S/C17H18N2O3/c1-12(2)19(3)17(20)16-9-8-14(22-16)11-21-15-7-5-4-6-13(15)10-18/h4-9,12H,11H2,1-3H3 |
| InChIKey | QJFBGTFGPGWGOI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |