C27H21N3O4 — CID 55872708
N-(2-anilino-2-oxo-1-phenylethyl)-5-[(2-cyanophenoxy)methyl]furan-2-carboxamide (PubChem CID 55872708) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-(2-anilino-2-oxo-1-phenylethyl)-5-[(2-cyanophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-anilino-2-oxo-1-phenylethyl)-5-[(2-cyanophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55872708 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(2-anilino-2-oxo-1-phenylethyl)-5-[(2-cyanophenoxy)methyl]furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)NC(C(=O)Nc2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C27H21N3O4/c28-17-20-11-7-8-14-23(20)33-18-22-15-16-24(34-22)26(31)30-25(19-9-3-1-4-10-19)27(32)29-21-12-5-2-6-13-21/h1-16,25H,18H2,(H,29,32)(H,30,31) |
| InChIKey | HLZXXGLNPGTYRG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |