C23H20N4O4 — CID 55823378
5-[(2-cyanophenoxy)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]furan-2-carboxamide (PubChem CID 55823378) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55823378 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]furan-2-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)c2ccc(COc3ccccc3C#N)o2)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-2-13-25-23(29)27-18-9-7-17(8-10-18)26-22(28)21-12-11-19(31-21)15-30-20-6-4-3-5-16(20)14-24/h2-12H,1,13,15H2,(H,26,28)(H2,25,27,29) |
| InChIKey | AMURTFUSWFKDIC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|