C24H22N2O4 — CID 48585316
5-[(2-cyanophenoxy)methyl]-N-[3-(cyclopropylmethoxymethyl)phenyl]furan-2-carboxamide (PubChem CID 48585316) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[3-(cyclopropylmethoxymethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[3-(cyclopropylmethoxymethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 48585316 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[3-(cyclopropylmethoxymethyl)phenyl]furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)Nc2cccc(COCC3CC3)c2)o1 |
| InChI | InChI=1S/C24H22N2O4/c25-13-19-5-1-2-7-22(19)29-16-21-10-11-23(30-21)24(27)26-20-6-3-4-18(12-20)15-28-14-17-8-9-17/h1-7,10-12,17H,8-9,14-16H2,(H,26,27) |
| InChIKey | XPDLRXHYEHNRMI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |