C21H16N6O3S — CID 55871417
5-[(2-cyanophenoxy)methyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]furan-2-carboxamide (PubChem CID 55871417) has the molecular formula C21H16N6O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55871417 |
| Molecular Formula | C21H16N6O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]furan-2-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2ccc(COc3ccccc3C#N)o2)c1 |
| InChI | InChI=1S/C21H16N6O3S/c1-31-21-24-25-26-27(21)16-7-4-6-15(11-16)23-20(28)19-10-9-17(30-19)13-29-18-8-3-2-5-14(18)12-22/h2-11H,13H2,1H3,(H,23,28) |
| InChIKey | VXGMXFOKXAGYQQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |