C20H17N5O3 — CID 43845083
5-[(2-methylphenoxy)methyl]-N-[3-(tetrazol-1-yl)phenyl]furan-2-carboxamide (PubChem CID 43845083) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[(2-methylphenoxy)methyl]-N-[3-(tetrazol-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-methylphenoxy)methyl]-N-[3-(tetrazol-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43845083 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-[(2-methylphenoxy)methyl]-N-[3-(tetrazol-1-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1OCc1ccc(C(=O)Nc2cccc(-n3cnnn3)c2)o1 |
| InChI | InChI=1S/C20H17N5O3/c1-14-5-2-3-8-18(14)27-12-17-9-10-19(28-17)20(26)22-15-6-4-7-16(11-15)25-13-21-23-24-25/h2-11,13H,12H2,1H3,(H,22,26) |
| InChIKey | SYZHINLQFHYRBQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |