C19H27NO3 — CID 42459961
methyl 5-oxo-5-[(3R)-3-(2-phenylethyl)piperidin-1-yl]pentanoate (PubChem CID 42459961) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl 5-oxo-5-[(3R)-3-(2-phenylethyl)piperidin-1-yl]pentanoate.
| Compound Name | methyl 5-oxo-5-[(3R)-3-(2-phenylethyl)piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 42459961 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl 5-oxo-5-[(3R)-3-(2-phenylethyl)piperidin-1-yl]pentanoate |
| SMILES | COC(=O)CCCC(=O)N1CCC[C@@H](CCc2ccccc2)C1 |
| InChI | InChI=1S/C19H27NO3/c1-23-19(22)11-5-10-18(21)20-14-6-9-17(15-20)13-12-16-7-3-2-4-8-16/h2-4,7-8,17H,5-6,9-15H2,1H3/t17-/m0/s1 |
| InChIKey | PVQHVWBETIDLBY-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |