C19H29NO2 — CID 110416532
1-[3-(ethoxymethyl)piperidin-1-yl]-5-phenylpentan-1-one (PubChem CID 110416532) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[3-(ethoxymethyl)piperidin-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[3-(ethoxymethyl)piperidin-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 110416532 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[3-(ethoxymethyl)piperidin-1-yl]-5-phenylpentan-1-one |
| SMILES | CCOCC1CCCN(C(=O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-2-22-16-18-12-8-14-20(15-18)19(21)13-7-6-11-17-9-4-3-5-10-17/h3-5,9-10,18H,2,6-8,11-16H2,1H3 |
| InChIKey | QGLXWHBDMNNJBE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|