C24H29ClN2O2 — CID 45249030
2-chloro-N-[[1-(5-phenylpentanoyl)piperidin-3-yl]methyl]benzamide (PubChem CID 45249030) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 2-chloro-N-[[1-(5-phenylpentanoyl)piperidin-3-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[1-(5-phenylpentanoyl)piperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 45249030 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-chloro-N-[[1-(5-phenylpentanoyl)piperidin-3-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCCN(C(=O)CCCCc2ccccc2)C1)c1ccccc1Cl |
| InChI | InChI=1S/C24H29ClN2O2/c25-22-14-6-5-13-21(22)24(29)26-17-20-12-8-16-27(18-20)23(28)15-7-4-11-19-9-2-1-3-10-19/h1-3,5-6,9-10,13-14,20H,4,7-8,11-12,15-18H2,(H,26,29) |
| InChIKey | UICLCYWKHXOXMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|