C21H23ClN2O2S — CID 42594765
2-chloro-N-[[(3S)-1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]benzamide (PubChem CID 42594765) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-chloro-N-[[(3S)-1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[(3S)-1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42594765 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-chloro-N-[[(3S)-1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]benzamide |
| SMILES | CSc1ccccc1C(=O)N1CCC[C@@H](CNC(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C21H23ClN2O2S/c1-27-19-11-5-3-9-17(19)21(26)24-12-6-7-15(14-24)13-23-20(25)16-8-2-4-10-18(16)22/h2-5,8-11,15H,6-7,12-14H2,1H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | QQCVTEKDZZIVTC-HNNXBMFYSA-N |
| XLogP | 4.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |