C27H28N2O2S — CID 45224813
N-[[1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]-4-phenylbenzamide (PubChem CID 45224813) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[[1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]-4-phenylbenzamide.
| Compound Name | N-[[1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 45224813 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[[1-(2-methylsulfanylbenzoyl)piperidin-3-yl]methyl]-4-phenylbenzamide |
| SMILES | CSc1ccccc1C(=O)N1CCCC(CNC(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C27H28N2O2S/c1-32-25-12-6-5-11-24(25)27(31)29-17-7-8-20(19-29)18-28-26(30)23-15-13-22(14-16-23)21-9-3-2-4-10-21/h2-6,9-16,20H,7-8,17-19H2,1H3,(H,28,30) |
| InChIKey | YPRCPSSHUSRVGZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |