C28H27N3O2 — CID 45226176
N-[[1-(1H-indole-5-carbonyl)piperidin-3-yl]methyl]-4-phenylbenzamide (PubChem CID 45226176) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[[1-(1H-indole-5-carbonyl)piperidin-3-yl]methyl]-4-phenylbenzamide.
| Compound Name | N-[[1-(1H-indole-5-carbonyl)piperidin-3-yl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 45226176 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[[1-(1H-indole-5-carbonyl)piperidin-3-yl]methyl]-4-phenylbenzamide |
| SMILES | O=C(NCC1CCCN(C(=O)c2ccc3[nH]ccc3c2)C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O2/c32-27(23-10-8-22(9-11-23)21-6-2-1-3-7-21)30-18-20-5-4-16-31(19-20)28(33)25-12-13-26-24(17-25)14-15-29-26/h1-3,6-15,17,20,29H,4-5,16,18-19H2,(H,30,32) |
| InChIKey | AEFZIMPUKWTKED-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |