C23H25N3O3 — CID 58933443
benzyl 4-[(1H-indole-5-carbonylamino)methyl]piperidine-1-carboxylate (PubChem CID 58933443) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is benzyl 4-[(1H-indole-5-carbonylamino)methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(1H-indole-5-carbonylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933443 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | benzyl 4-[(1H-indole-5-carbonylamino)methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C23H25N3O3/c27-22(20-6-7-21-19(14-20)8-11-24-21)25-15-17-9-12-26(13-10-17)23(28)29-16-18-4-2-1-3-5-18/h1-8,11,14,17,24H,9-10,12-13,15-16H2,(H,25,27) |
| InChIKey | PWPKSVPPXSRZQA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |