C20H23N5O2 — CID 126779705
N-[[1-(1H-indole-5-carbonyl)piperidin-4-yl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 126779705) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[[1-(1H-indole-5-carbonyl)piperidin-4-yl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[[1-(1H-indole-5-carbonyl)piperidin-4-yl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126779705 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[[1-(1H-indole-5-carbonyl)piperidin-4-yl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCC2CCN(C(=O)c3ccc4[nH]ccc4c3)CC2)cn1 |
| InChI | InChI=1S/C20H23N5O2/c1-24-13-17(12-23-24)19(26)22-11-14-5-8-25(9-6-14)20(27)16-2-3-18-15(10-16)4-7-21-18/h2-4,7,10,12-14,21H,5-6,8-9,11H2,1H3,(H,22,26) |
| InChIKey | MFGQCBREAKOKDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |