C24H28N2O4 — CID 58933564
(4-methylphenyl)methyl 4-[[(4-acetylbenzoyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 58933564) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4-methylphenyl)methyl 4-[[(4-acetylbenzoyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | (4-methylphenyl)methyl 4-[[(4-acetylbenzoyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933564 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (4-methylphenyl)methyl 4-[[(4-acetylbenzoyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(=O)c1ccc(C(=O)NCC2CCN(C(=O)OCc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-17-3-5-20(6-4-17)16-30-24(29)26-13-11-19(12-14-26)15-25-23(28)22-9-7-21(8-10-22)18(2)27/h3-10,19H,11-16H2,1-2H3,(H,25,28) |
| InChIKey | GAXYOVWDSWLZGW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |