C19H22N4O4 — CID 58933592
benzyl 4-[[(5-hydroxypyrimidine-2-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 58933592) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is benzyl 4-[[(5-hydroxypyrimidine-2-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[(5-hydroxypyrimidine-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933592 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | benzyl 4-[[(5-hydroxypyrimidine-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ncc(O)cn1 |
| InChI | InChI=1S/C19H22N4O4/c24-16-11-20-17(21-12-16)18(25)22-10-14-6-8-23(9-7-14)19(26)27-13-15-4-2-1-3-5-15/h1-5,11-12,14,24H,6-10,13H2,(H,22,25) |
| InChIKey | JYOZGTSMKBERES-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |