C20H25N5O3 — CID 58933693
benzyl 4-[[[2-(methylamino)pyrimidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 58933693) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is benzyl 4-[[[2-(methylamino)pyrimidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[[2-(methylamino)pyrimidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933693 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | benzyl 4-[[[2-(methylamino)pyrimidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CNc1nccc(C(=O)NCC2CCN(C(=O)OCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H25N5O3/c1-21-19-22-10-7-17(24-19)18(26)23-13-15-8-11-25(12-9-15)20(27)28-14-16-5-3-2-4-6-16/h2-7,10,15H,8-9,11-14H2,1H3,(H,23,26)(H,21,22,24) |
| InChIKey | TWWZRMDEIOUQPY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |