C20H22BrN3O3 — CID 58933764
benzyl 4-[[(3-bromopyridine-4-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 58933764) has the molecular formula C20H22BrN3O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is benzyl 4-[[(3-bromopyridine-4-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[(3-bromopyridine-4-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933764 |
| Molecular Formula | C20H22BrN3O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | benzyl 4-[[(3-bromopyridine-4-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccncc1Br |
| InChI | InChI=1S/C20H22BrN3O3/c21-18-13-22-9-6-17(18)19(25)23-12-15-7-10-24(11-8-15)20(26)27-14-16-4-2-1-3-5-16/h1-6,9,13,15H,7-8,10-12,14H2,(H,23,25) |
| InChIKey | XMBMGLVWCFWEMN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |